Molecular, Crystal and Chemical Models
eMolecules 742108-76-5 | 4,4'-(pyridine-3,5-diylbis(ethyne-2,1-diyl))bis(2-methoxyphenol) | Synthonix371.392 | C23H17NO4 | 95.000 | COc1cc(ccc1O)C#Cc1cncc(c1)C#Cc1ccc(O)c(OC)c1 | 100mg | 794075869
4,4'-(pyridine-3,5-diylbis(ethyne-2,1-diyl))bis(2-methoxyphenol) | Synthonix | 742108-76-5371.392 | C23H17NO4 | 95.000 | COc1cc(ccc1O)C#Cc1cncc(c1)C#Cc1ccc(O)c(OC)c1 | 100mg | 794075869
Biolegend FluoroSpot MAXTM Deluxe Set Hu
FluoroSpot MAX Deluxe Set Human Granzyme B Reactivity Human Apps FluoroSpot Size 5 Plates
![eMolecules 960304-79-4 | methyl 2-[2-(pyridin-4-yl)phenyl]acetate | Synthonix227.263 | C14H13NO2 | 98.000 | COC(=O)Cc1ccccc1-c1ccncc1 | 5mg | 786491204](https://assets.fishersci.com/TFS-Assets/CCG/product-images/502478208.JPG-250.jpg)
eMolecules 960304-79-4 | methyl 2-[2-(pyridin-4-yl)phenyl]acetate | Synthonix227.263 | C14H13NO2 | 98.000 | COC(=O)Cc1ccccc1-c1ccncc1 | 5mg | 786491204
methyl 2-[2-(pyridin-4-yl)phenyl]acetate | Synthonix | 960304-79-4227.263 | C14H13NO2 | 98.000 | COC(=O)Cc1ccccc1-c1ccncc1 | 5mg | 786491204
Enterprise Technology Solutions Learning Resources Sensory Bottles Set,Feelings,4/Set
Express Your Feelings Sensory Bottles provide children with quiet, self-directed, tangible ways to identify how they're feeling, how to release the energy those feelings create and how to calm down. Each bottle features a unique emotion, color and interactive element that ties to one of four emotions - happy, angry, scared and sad. Easy-to-grip, securely sealed bottles help children learn to use facial and body clues to identify their emotions. Activity guide is designed to encourage discussion/conversation about responding to emotions in positive, proactive ways.
eMolecules 300802-28-2 | CIL56 | Ambeed | MFCD00323348 | 489.610 | C23H27N3O5S2 | 99.000 | ON=C1c2cc(ccc2-c2ccc(cc12)S(=O)(=O)N1CCCCC1)S(=O)(=O)N1CCCCC1 | 1mg | 491174303
CIL56 | Ambeed | 300802-28-2 | MFCD00323348 | 489.610 | C23H27N3O5S2 | 99.000 | ON=C1c2cc(ccc2-c2ccc(cc12)S(=O)(=O)N1CCCCC1)S(=O)(=O)N1CCCCC1 | 1mg | 491174303
Ryler Enterprises Advanced Organic Stereochemistry Model Set
Expands understanding of stereochemistry with sp3, sp2, and sp bonding, aromatic rings, and trigonal planar atom centers.